Function 1. It's a kind of nutritional supplement. 2. It can improve the aerobic metabolism of the muscle and greatly enhance muscle strength and endurance from diet alone. 3. It can be used as nutrition enhancer. 4. It's one of the most popular and…
Feline infectious peritonitis (FIP) is a devastating and almost always fatal feline disease arising from mutations in the common feline coronavirus (FECV), which infect 40-80% of cats worldwide. GS-441524, also known as GS-5734, is a potent inhibitor…
Xylazine is an analogue of an agonist at the α2 class of adrenergic receptor. It is used for sedation, anesthesia, muscle relaxation, and analgesia in animals such as horses, cattle and other non-human mammals. Veterinarians also use xylazine as an…
Name: N-(4-Fluorophenyl)piperidin-4-amine CAS: 38043-08-2? Molecular weight: 194.25 Formula: C11H15FN2 MDL: MFCD06619353 InChI: InChI=1S/C11H15FN2/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11/h1-4,11,13-14H,5-8H2 Precise quality:194.12200 PSA:24.06000…
Product Name: 2-(2-chlorophenyl)cyclohexanone CAS No.: 91393-49-6 Molecular Formula: C12H13ClO Molecular Weight: 208.68 Other Name: 2-(2-chlorophenyl)cyclohexanone;2-(2-chlorophenyl)cyclohexan-1-one;Cyclohexanone, 2-(2-chlorophenyl)- LogP: 3.56670 PSA:…